C18H17Cl3N6O2 — CID 23729617
4-chloro-N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(6-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]benzamide (PubChem CID 23729617) has the molecular formula C18H17Cl3N6O2 and a molecular weight of 455.73 g/mol. Its IUPAC name is 4-chloro-N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(6-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]benzamide.
| Compound Name | 4-chloro-N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(6-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 23729617 |
| Molecular Formula | C18H17Cl3N6O2 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 4-chloro-N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(6-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]benzamide |
| SMILES | COc1ccc(N/C(=N/C(NC(=O)c2ccc(Cl)cc2)C(C)(Cl)Cl)NC#N)cn1 |
| InChI | InChI=1S/C18H17Cl3N6O2/c1-18(20,21)16(26-15(28)11-3-5-12(19)6-4-11)27-17(24-10-22)25-13-7-8-14(29-2)23-9-13/h3-9,16H,1-2H3,(H,26,28)(H2,24,25,27) |
| InChIKey | OZFHVRJRMHPLEO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|