C17H18ClF2N3O3 — CID 8558761
N-(2-chloro-3-pyridinyl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]acetamide (PubChem CID 8558761) has the molecular formula C17H18ClF2N3O3 and a molecular weight of 385.80 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 8558761 |
| Molecular Formula | C17H18ClF2N3O3 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl-methylamino]acetamide |
| SMILES | COc1cc(CN(C)CC(=O)Nc2cccnc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C17H18ClF2N3O3/c1-23(10-15(24)22-12-4-3-7-21-16(12)18)9-11-5-6-13(26-17(19)20)14(8-11)25-2/h3-8,17H,9-10H2,1-2H3,(H,22,24) |
| InChIKey | UIQIEWIWMZRNNN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|