C16H18BrN5O3S — CID 1295836
ethyl 4-[[(4-bromo-1,3-dimethylpyrazole-5-carbonyl)amino]carbamothioylamino]benzoate (PubChem CID 1295836) has the molecular formula C16H18BrN5O3S and a molecular weight of 440.32 g/mol. Its IUPAC name is ethyl 4-[[(4-bromo-1,3-dimethylpyrazole-5-carbonyl)amino]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[(4-bromo-1,3-dimethylpyrazole-5-carbonyl)amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 1295836 |
| Molecular Formula | C16H18BrN5O3S |
| Molecular Weight | 440.32 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | ethyl 4-[[(4-bromo-1,3-dimethylpyrazole-5-carbonyl)amino]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NNC(=O)c2c(Br)c(C)nn2C)cc1 |
| InChI | InChI=1S/C16H18BrN5O3S/c1-4-25-15(24)10-5-7-11(8-6-10)18-16(26)20-19-14(23)13-12(17)9(2)21-22(13)3/h5-8H,4H2,1-3H3,(H,19,23)(H2,18,20,26) |
| InChIKey | OXAVMNOAQFAGSS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_C(9)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|