C17H20BrN5O3S — CID 19584606
ethyl 4-[[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioylamino]benzoate (PubChem CID 19584606) has the molecular formula C17H20BrN5O3S and a molecular weight of 454.35 g/mol. Its IUPAC name is ethyl 4-[[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 19584606 |
| Molecular Formula | C17H20BrN5O3S |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | ethyl 4-[[[2-(4-bromo-3,5-dimethylpyrazol-1-yl)acetyl]amino]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NNC(=O)Cn2nc(C)c(Br)c2C)cc1 |
| InChI | InChI=1S/C17H20BrN5O3S/c1-4-26-16(25)12-5-7-13(8-6-12)19-17(27)21-20-14(24)9-23-11(3)15(18)10(2)22-23/h5-8H,4,9H2,1-3H3,(H,20,24)(H2,19,21,27) |
| InChIKey | UAXYXZVKSOVIBO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|