C14H15BrN4OS — CID 62128720
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(4-carbamothioylphenyl)acetamide (PubChem CID 62128720) has the molecular formula C14H15BrN4OS and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(4-carbamothioylphenyl)acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(4-carbamothioylphenyl)acetamide |
|---|---|
| PubChem CID | 62128720 |
| Molecular Formula | C14H15BrN4OS |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(4-carbamothioylphenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc(C(N)=S)cc2)c(C)c1Br |
| InChI | InChI=1S/C14H15BrN4OS/c1-8-13(15)9(2)19(18-8)7-12(20)17-11-5-3-10(4-6-11)14(16)21/h3-6H,7H2,1-2H3,(H2,16,21)(H,17,20) |
| InChIKey | OPUOEWJAOVVMAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|