C13H13BrClN3O2 — CID 19525429
2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-hydroxyphenyl)acetamide (PubChem CID 19525429) has the molecular formula C13H13BrClN3O2 and a molecular weight of 358.62 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19525429 |
| Molecular Formula | C13H13BrClN3O2 |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-(5-chloro-2-hydroxyphenyl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2cc(Cl)ccc2O)c(C)c1Br |
| InChI | InChI=1S/C13H13BrClN3O2/c1-7-13(14)8(2)18(17-7)6-12(20)16-10-5-9(15)3-4-11(10)19/h3-5,19H,6H2,1-2H3,(H,16,20) |
| InChIKey | GCPGLUWOVMSHQY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|