C13H10ClF4N3O2 — CID 19518008
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide (PubChem CID 19518008) has the molecular formula C13H10ClF4N3O2 and a molecular weight of 351.69 g/mol. Its IUPAC name is 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide.
| Compound Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 19518008 |
| Molecular Formula | C13H10ClF4N3O2 |
| Molecular Weight | 351.69 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(5-chloro-2-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C(F)F)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C13H10ClF4N3O2/c14-6-1-2-10(22)7(3-6)19-11(23)5-21-9(13(17)18)4-8(20-21)12(15)16/h1-4,12-13,22H,5H2,(H,19,23) |
| InChIKey | HJRBXRQSMOBHSS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|