C14H11ClF4N4O — CID 5430332
2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide (PubChem CID 5430332) has the molecular formula C14H11ClF4N4O and a molecular weight of 362.71 g/mol. Its IUPAC name is 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5430332 |
| Molecular Formula | C14H11ClF4N4O |
| Molecular Weight | 362.71 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]-N-[(Z)-(4-chlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C(F)F)N/N=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClF4N4O/c15-9-3-1-8(2-4-9)6-20-21-12(24)7-23-11(14(18)19)5-10(22-23)13(16)17/h1-6,13-14H,7H2,(H,21,24)/b20-6- |
| InChIKey | YQACJPPOAJLVAD-IOXNKQMXSA-N |
| XLogP | 3.56 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.71 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|