C17H22N4O2S — CID 2955199
ethyl 4-[1-(1,3-dimethylpyrazol-4-yl)ethylcarbamothioylamino]benzoate (PubChem CID 2955199) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is ethyl 4-[1-(1,3-dimethylpyrazol-4-yl)ethylcarbamothioylamino]benzoate.
| Compound Name | ethyl 4-[1-(1,3-dimethylpyrazol-4-yl)ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2955199 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 4-[1-(1,3-dimethylpyrazol-4-yl)ethylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NC(C)c2cn(C)nc2C)cc1 |
| InChI | InChI=1S/C17H22N4O2S/c1-5-23-16(22)13-6-8-14(9-7-13)19-17(24)18-11(2)15-10-21(4)20-12(15)3/h6-11H,5H2,1-4H3,(H2,18,19,24) |
| InChIKey | ORRUMSHEZKWEDN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|