C16H16N2O2S2 — CID 2781173
ethyl 4-[(2-sulfanylphenyl)carbamothioylamino]benzoate (PubChem CID 2781173) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethyl 4-[(2-sulfanylphenyl)carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[(2-sulfanylphenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2781173 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl 4-[(2-sulfanylphenyl)carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)Nc2ccccc2S)cc1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-2-20-15(19)11-7-9-12(10-8-11)17-16(22)18-13-5-3-4-6-14(13)21/h3-10,21H,2H2,1H3,(H2,17,18,22) |
| InChIKey | CSDWZBTUXPCRMU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|