C22H25BrN4O5S2 — CID 2955027
ethyl 4-[[[1-(4-bromophenyl)sulfonylpiperidine-4-carbonyl]amino]carbamothioylamino]benzoate (PubChem CID 2955027) has the molecular formula C22H25BrN4O5S2 and a molecular weight of 569.50 g/mol. Its IUPAC name is ethyl 4-[[[1-(4-bromophenyl)sulfonylpiperidine-4-carbonyl]amino]carbamothioylamino]benzoate.
| Compound Name | ethyl 4-[[[1-(4-bromophenyl)sulfonylpiperidine-4-carbonyl]amino]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 2955027 |
| Molecular Formula | C22H25BrN4O5S2 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | ethyl 4-[[[1-(4-bromophenyl)sulfonylpiperidine-4-carbonyl]amino]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)NNC(=O)C2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H25BrN4O5S2/c1-2-32-21(29)16-3-7-18(8-4-16)24-22(33)26-25-20(28)15-11-13-27(14-12-15)34(30,31)19-9-5-17(23)6-10-19/h3-10,15H,2,11-14H2,1H3,(H,25,28)(H2,24,26,33) |
| InChIKey | MSEKJVFOQGDHJK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|