C20H28N2O4 — CID 30544768
N-(3-butoxypropyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide (PubChem CID 30544768) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide.
| Compound Name | N-(3-butoxypropyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 30544768 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-(3-butoxypropyl)-2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzamide |
| SMILES | CCCCOCCCNC(=O)c1ccccc1OCc1c(C)noc1C |
| InChI | InChI=1S/C20H28N2O4/c1-4-5-12-24-13-8-11-21-20(23)17-9-6-7-10-19(17)25-14-18-15(2)22-26-16(18)3/h6-7,9-10H,4-5,8,11-14H2,1-3H3,(H,21,23) |
| InChIKey | OGJXZSFWXFEMOE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|