C22H27N5O4 — CID 24627420
N'-(4-butoxy-3-methoxybenzoyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbohydrazide (PubChem CID 24627420) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is N'-(4-butoxy-3-methoxybenzoyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(4-butoxy-3-methoxybenzoyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 24627420 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N'-(4-butoxy-3-methoxybenzoyl)-1,3,6-trimethylpyrazolo[3,4-b]pyridine-4-carbohydrazide |
| SMILES | CCCCOc1ccc(C(=O)NNC(=O)c2cc(C)nc3c2c(C)nn3C)cc1OC |
| InChI | InChI=1S/C22H27N5O4/c1-6-7-10-31-17-9-8-15(12-18(17)30-5)21(28)24-25-22(29)16-11-13(2)23-20-19(16)14(3)26-27(20)4/h8-9,11-12H,6-7,10H2,1-5H3,(H,24,28)(H,25,29) |
| InChIKey | MFTXPOBGWOGTTG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|