C19H14F3NO3S — CID 43000512
N-[2-(difluoromethylsulfanyl)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 43000512) has the molecular formula C19H14F3NO3S and a molecular weight of 393.39 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43000512 |
| Molecular Formula | C19H14F3NO3S |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-[(4-fluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1SC(F)F)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H14F3NO3S/c20-12-5-7-13(8-6-12)25-11-14-9-10-16(26-14)18(24)23-15-3-1-2-4-17(15)27-19(21)22/h1-10,19H,11H2,(H,23,24) |
| InChIKey | TWPAIHJUCLMBRF-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |