C25H20ClNO4S — CID 19451074
N-[2-(4-chlorophenyl)sulfanylphenyl]-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide (PubChem CID 19451074) has the molecular formula C25H20ClNO4S and a molecular weight of 465.96 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19451074 |
| Molecular Formula | C25H20ClNO4S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-5-[(4-methoxyphenoxy)methyl]furan-2-carboxamide |
| SMILES | COc1ccc(OCc2ccc(C(=O)Nc3ccccc3Sc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C25H20ClNO4S/c1-29-18-8-10-19(11-9-18)30-16-20-12-15-23(31-20)25(28)27-22-4-2-3-5-24(22)32-21-13-6-17(26)7-14-21/h2-15H,16H2,1H3,(H,27,28) |
| InChIKey | XZHBZJFYOGRVIO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |