C25H21NO3S — CID 19465579
5-[(3-methylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide (PubChem CID 19465579) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is 5-[(3-methylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(3-methylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19465579 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 5-[(3-methylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(OCc2ccc(C(=O)Nc3ccccc3Sc3ccccc3)o2)c1 |
| InChI | InChI=1S/C25H21NO3S/c1-18-8-7-9-19(16-18)28-17-20-14-15-23(29-20)25(27)26-22-12-5-6-13-24(22)30-21-10-3-2-4-11-21/h2-16H,17H2,1H3,(H,26,27) |
| InChIKey | JJIIVQNUBSDHKC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |