C28H27NO3S — CID 19450441
5-[(4-butan-2-ylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide (PubChem CID 19450441) has the molecular formula C28H27NO3S and a molecular weight of 457.60 g/mol. Its IUPAC name is 5-[(4-butan-2-ylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide.
| Compound Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19450441 |
| Molecular Formula | C28H27NO3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 5-[(4-butan-2-ylphenoxy)methyl]-N-(2-phenylsulfanylphenyl)furan-2-carboxamide |
| SMILES | CCC(C)c1ccc(OCc2ccc(C(=O)Nc3ccccc3Sc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C28H27NO3S/c1-3-20(2)21-13-15-22(16-14-21)31-19-23-17-18-26(32-23)28(30)29-25-11-7-8-12-27(25)33-24-9-5-4-6-10-24/h4-18,20H,3,19H2,1-2H3,(H,29,30) |
| InChIKey | DHVGZCFYQHTQNV-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |