C18H23N3O — CID 78874188
1-benzyl-N-cyclopentyl-5-ethylpyrazole-4-carboxamide (PubChem CID 78874188) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-benzyl-N-cyclopentyl-5-ethylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-cyclopentyl-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78874188 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-benzyl-N-cyclopentyl-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NC2CCCC2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c1-2-17-16(18(22)20-15-10-6-7-11-15)12-19-21(17)13-14-8-4-3-5-9-14/h3-5,8-9,12,15H,2,6-7,10-11,13H2,1H3,(H,20,22) |
| InChIKey | UJACNZVPFZQCDM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |