C23H29N3O — CID 78873962
N-(1-adamantyl)-1-benzyl-5-ethylpyrazole-4-carboxamide (PubChem CID 78873962) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is N-(1-adamantyl)-1-benzyl-5-ethylpyrazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-benzyl-5-ethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78873962 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | N-(1-adamantyl)-1-benzyl-5-ethylpyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NC23CC4CC(CC(C4)C2)C3)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H29N3O/c1-2-21-20(14-24-26(21)15-16-6-4-3-5-7-16)22(27)25-23-11-17-8-18(12-23)10-19(9-17)13-23/h3-7,14,17-19H,2,8-13,15H2,1H3,(H,25,27) |
| InChIKey | IIVUSSCFUBDHTP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |