C27H30N4O — CID 68502715
N-(1-adamantyl)-5-(benzylamino)-1-phenylpyrazole-4-carboxamide (PubChem CID 68502715) has the molecular formula C27H30N4O and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(1-adamantyl)-5-(benzylamino)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-5-(benzylamino)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 68502715 |
| Molecular Formula | C27H30N4O |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-(1-adamantyl)-5-(benzylamino)-1-phenylpyrazole-4-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cnn(-c2ccccc2)c1NCc1ccccc1 |
| InChI | InChI=1S/C27H30N4O/c32-26(30-27-14-20-11-21(15-27)13-22(12-20)16-27)24-18-29-31(23-9-5-2-6-10-23)25(24)28-17-19-7-3-1-4-8-19/h1-10,18,20-22,28H,11-17H2,(H,30,32) |
| InChIKey | CREVTDICLLUEEP-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |