C18H22N4O3 — CID 78873658
1-benzyl-5-ethyl-N'-(oxolane-2-carbonyl)pyrazole-4-carbohydrazide (PubChem CID 78873658) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-benzyl-5-ethyl-N'-(oxolane-2-carbonyl)pyrazole-4-carbohydrazide.
| Compound Name | 1-benzyl-5-ethyl-N'-(oxolane-2-carbonyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 78873658 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-benzyl-5-ethyl-N'-(oxolane-2-carbonyl)pyrazole-4-carbohydrazide |
| SMILES | CCc1c(C(=O)NNC(=O)C2CCCO2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N4O3/c1-2-15-14(11-19-22(15)12-13-7-4-3-5-8-13)17(23)20-21-18(24)16-9-6-10-25-16/h3-5,7-8,11,16H,2,6,9-10,12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ABLRDUFUAUFWSY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|