C21H23N3O4S — CID 38496686
N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1,2-oxazole-5-carboxamide (PubChem CID 38496686) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 38496686 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-(4-methylphenyl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCNS(=O)(=O)c3cc(C)ccc3C)on2)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-14-5-8-17(9-6-14)18-13-19(28-24-18)21(25)22-10-11-23-29(26,27)20-12-15(2)4-7-16(20)3/h4-9,12-13,23H,10-11H2,1-3H3,(H,22,25) |
| InChIKey | LULLNFCAKIMXIJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|