C19H26N4O2S — CID 110952970
1-benzyl-3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methylguanidine (PubChem CID 110952970) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 1-benzyl-3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methylguanidine.
| Compound Name | 1-benzyl-3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110952970 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-benzyl-3-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCNS(=O)(=O)c1cc(C)ccc1C)NCc1ccccc1 |
| InChI | InChI=1S/C19H26N4O2S/c1-15-9-10-16(2)18(13-15)26(24,25)23-12-11-21-19(20-3)22-14-17-7-5-4-6-8-17/h4-10,13,23H,11-12,14H2,1-3H3,(H2,20,21,22) |
| InChIKey | YEYSPXARQMVSGA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|