C20H33IN6O2S — CID 111279388
1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111279388) has the molecular formula C20H33IN6O2S and a molecular weight of 548.50 g/mol. Its IUPAC name is 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111279388 |
| Molecular Formula | C20H33IN6O2S |
| Molecular Weight | 548.50 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[2-[(2,5-dimethylphenyl)sulfonylamino]ethyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCCNS(=O)(=O)c1cc(C)ccc1C.I |
| InChI | InChI=1S/C20H32N6O2S.HI/c1-15-7-8-16(2)19(13-15)29(27,28)24-11-10-23-20(21-5)22-9-6-12-26-18(4)14-17(3)25-26;/h7-8,13-14,24H,6,9-12H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | GOBGPNWQICYYCY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|