C30H31N5O4S — CID 124542262
N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 124542262) has the molecular formula C30H31N5O4S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 124542262 |
| Molecular Formula | C30H31N5O4S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[[4-[5-[(2S)-butan-2-yl]-1,3-benzoxazol-2-yl]phenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CC[C@H](C)c1ccc2oc(-c3ccc(NC(=S)NC(=O)c4ccc(N5CCCCC5)c([N+](=O)[O-])c4)cc3)nc2c1 |
| InChI | InChI=1S/C30H31N5O4S/c1-3-19(2)21-10-14-27-24(17-21)32-29(39-27)20-7-11-23(12-8-20)31-30(40)33-28(36)22-9-13-25(26(18-22)35(37)38)34-15-5-4-6-16-34/h7-14,17-19H,3-6,15-16H2,1-2H3,(H2,31,33,36,40)/t19-/m0/s1 |
| InChIKey | NUAWTNIMBDIABF-IBGZPJMESA-N |
| XLogP | 7.03 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|