C27H25N5O5S — CID 17316442
N-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 17316442) has the molecular formula C27H25N5O5S and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17316442 |
| Molecular Formula | C27H25N5O5S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]carbamothioyl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | COc1ccc(-c2nc3ccccc3o2)cc1NC(=S)NC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25N5O5S/c1-36-23-12-10-18(26-28-19-7-3-4-8-24(19)37-26)15-20(23)29-27(38)30-25(33)17-9-11-21(22(16-17)32(34)35)31-13-5-2-6-14-31/h3-4,7-12,15-16H,2,5-6,13-14H2,1H3,(H2,29,30,33,38) |
| InChIKey | XTBIUCPRYYXYEL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|