C26H21Cl2N5O4S — CID 17315208
N-[[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 17315208) has the molecular formula C26H21Cl2N5O4S and a molecular weight of 570.46 g/mol. Its IUPAC name is N-[[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 17315208 |
| Molecular Formula | C26H21Cl2N5O4S |
| Molecular Weight | 570.46 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | N-[[5-(5,7-dichloro-1,3-benzoxazol-2-yl)-2-methylphenyl]carbamothioyl]-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | Cc1ccc(-c2nc3cc(Cl)cc(Cl)c3o2)cc1NC(=S)NC(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21Cl2N5O4S/c1-14-4-5-16(25-29-20-13-17(27)12-18(28)23(20)37-25)10-19(14)30-26(38)31-24(34)15-6-7-21(22(11-15)33(35)36)32-8-2-3-9-32/h4-7,10-13H,2-3,8-9H2,1H3,(H2,30,31,34,38) |
| InChIKey | GDODRUJQNSDTMA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|