C24H23N3O4 — CID 56545372
4-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]carbamoyl]phenoxy]benzamide (PubChem CID 56545372) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545372 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 4-[4-[[2-(2,6-dimethylanilino)-2-oxoethyl]carbamoyl]phenoxy]benzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O4/c1-15-4-3-5-16(2)22(15)27-21(28)14-26-24(30)18-8-12-20(13-9-18)31-19-10-6-17(7-11-19)23(25)29/h3-13H,14H2,1-2H3,(H2,25,29)(H,26,30)(H,27,28) |
| InChIKey | RVNSJJKXEBKDPW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |