C26H27N3O4 — CID 56546028
4-[4-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]carbamoyl]phenoxy]benzamide (PubChem CID 56546028) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[4-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56546028 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[4-[methyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]carbamoyl]phenoxy]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-16-13-17(2)24(18(3)14-16)28-23(30)15-29(4)26(32)20-7-11-22(12-8-20)33-21-9-5-19(6-10-21)25(27)31/h5-14H,15H2,1-4H3,(H2,27,31)(H,28,30) |
| InChIKey | ZNABUVVXYPKSAJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |