C18H20N2O3 — CID 7931575
4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]benzamide (PubChem CID 7931575) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]benzamide.
| Compound Name | 4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]benzamide |
|---|---|
| PubChem CID | 7931575 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[2-oxo-2-(2,4,6-trimethylanilino)ethoxy]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2ccc(C(N)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-11-8-12(2)17(13(3)9-11)20-16(21)10-23-15-6-4-14(5-7-15)18(19)22/h4-9H,10H2,1-3H3,(H2,19,22)(H,20,21) |
| InChIKey | JOMBEQLCSBEIKL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |