C25H26N2O4 — CID 26080587
2-[[2-(4-phenoxyphenoxy)acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 26080587) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-[[2-(4-phenoxyphenoxy)acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[2-(4-phenoxyphenoxy)acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 26080587 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-[[2-(4-phenoxyphenoxy)acetyl]amino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)COc2ccc(Oc3ccccc3)cc2)c(C)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-17-13-18(2)25(19(3)14-17)27-23(28)15-26-24(29)16-30-20-9-11-22(12-10-20)31-21-7-5-4-6-8-21/h4-14H,15-16H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | ZEJPFPPULMMSRD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |