C16H15ClINO2 — CID 24607292
N-(2-chloro-4,6-dimethylphenyl)-2-(4-iodophenoxy)acetamide (PubChem CID 24607292) has the molecular formula C16H15ClINO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(4-iodophenoxy)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(4-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 24607292 |
| Molecular Formula | C16H15ClINO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(4-iodophenoxy)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2ccc(I)cc2)c(Cl)c1 |
| InChI | InChI=1S/C16H15ClINO2/c1-10-7-11(2)16(14(17)8-10)19-15(20)9-21-13-5-3-12(18)4-6-13/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | GNAIHMJPEKMHSO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|