C17H18ClNO4S — CID 55733108
N-(2-chloro-4,6-dimethylphenyl)-2-(3-methylsulfonylphenoxy)acetamide (PubChem CID 55733108) has the molecular formula C17H18ClNO4S and a molecular weight of 367.85 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-2-(3-methylsulfonylphenoxy)acetamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-methylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 55733108 |
| Molecular Formula | C17H18ClNO4S |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-2-(3-methylsulfonylphenoxy)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)COc2cccc(S(C)(=O)=O)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClNO4S/c1-11-7-12(2)17(15(18)8-11)19-16(20)10-23-13-5-4-6-14(9-13)24(3,21)22/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | JGNVFQUIHBKELW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |