C20H23IN2O3 — CID 112761998
2-[[2-(4-iodophenoxy)acetyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 112761998) has the molecular formula C20H23IN2O3 and a molecular weight of 466.32 g/mol. Its IUPAC name is 2-[[2-(4-iodophenoxy)acetyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[[2-(4-iodophenoxy)acetyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 112761998 |
| Molecular Formula | C20H23IN2O3 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 2-[[2-(4-iodophenoxy)acetyl]-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)COc2ccc(I)cc2)c(C)c1 |
| InChI | InChI=1S/C20H23IN2O3/c1-13-9-14(2)20(15(3)10-13)22-18(24)11-23(4)19(25)12-26-17-7-5-16(21)6-8-17/h5-10H,11-12H2,1-4H3,(H,22,24) |
| InChIKey | RPHRLDNZUMTZDE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|