C22H25IN2O3 — CID 17497320
4-(4-iodophenyl)-N-methyl-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]butanamide (PubChem CID 17497320) has the molecular formula C22H25IN2O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is 4-(4-iodophenyl)-N-methyl-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]butanamide.
| Compound Name | 4-(4-iodophenyl)-N-methyl-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 17497320 |
| Molecular Formula | C22H25IN2O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-(4-iodophenyl)-N-methyl-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]butanamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)CCC(=O)c2ccc(I)cc2)c(C)c1 |
| InChI | InChI=1S/C22H25IN2O3/c1-14-11-15(2)22(16(3)12-14)24-20(27)13-25(4)21(28)10-9-19(26)17-5-7-18(23)8-6-17/h5-8,11-12H,9-10,13H2,1-4H3,(H,24,27) |
| InChIKey | HEOJAUAQQWCMFC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|