C17H17N5O2 — CID 24682012
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2H-benzotriazole-5-carboxamide (PubChem CID 24682012) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 24682012 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-2H-benzotriazole-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CNC(=O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C17H17N5O2/c1-10-4-3-5-11(2)16(10)19-15(23)9-18-17(24)12-6-7-13-14(8-12)21-22-20-13/h3-8H,9H2,1-2H3,(H,18,24)(H,19,23)(H,20,21,22) |
| InChIKey | JZNDJSJZFWLGDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |