C14H11Cl2N3O3 — CID 60512470
3,4-dichloro-N-[2-oxo-2-[(4-oxo-1H-pyridin-3-yl)amino]ethyl]benzamide (PubChem CID 60512470) has the molecular formula C14H11Cl2N3O3 and a molecular weight of 340.17 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-[(4-oxo-1H-pyridin-3-yl)amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-[(4-oxo-1H-pyridin-3-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 60512470 |
| Molecular Formula | C14H11Cl2N3O3 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-[(4-oxo-1H-pyridin-3-yl)amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)Nc1c[nH]ccc1=O |
| InChI | InChI=1S/C14H11Cl2N3O3/c15-9-2-1-8(5-10(9)16)14(22)18-7-13(21)19-11-6-17-4-3-12(11)20/h1-6H,7H2,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | FVWVORIYAAHOHY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |