C7H7ClN2O2 — CID 46737876
2-chloro-N-(4-oxo-1H-pyridin-3-yl)acetamide (PubChem CID 46737876) has the molecular formula C7H7ClN2O2 and a molecular weight of 186.60 g/mol. Its IUPAC name is 2-chloro-N-(4-oxo-1H-pyridin-3-yl)acetamide.
| Compound Name | 2-chloro-N-(4-oxo-1H-pyridin-3-yl)acetamide |
|---|---|
| PubChem CID | 46737876 |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.60 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 2-chloro-N-(4-oxo-1H-pyridin-3-yl)acetamide |
| SMILES | O=C(CCl)Nc1c[nH]ccc1=O |
| InChI | InChI=1S/C7H7ClN2O2/c8-3-7(12)10-5-4-9-2-1-6(5)11/h1-2,4H,3H2,(H,9,11)(H,10,12) |
| InChIKey | TVIAIJBHZUPFRB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.60 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|