C13H10Cl2N2O2S — CID 110698088
N-[2-(2,6-dichloroanilino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 110698088) has the molecular formula C13H10Cl2N2O2S and a molecular weight of 329.21 g/mol. Its IUPAC name is N-[2-(2,6-dichloroanilino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110698088 |
| Molecular Formula | C13H10Cl2N2O2S |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | N-[2-(2,6-dichloroanilino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H10Cl2N2O2S/c14-8-3-1-4-9(15)12(8)17-11(18)7-16-13(19)10-5-2-6-20-10/h1-6H,7H2,(H,16,19)(H,17,18) |
| InChIKey | JYOSBNQBZXHXKW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |