C12H12Cl2N2O5 — CID 63646991
2-[carboxymethyl-[2-(2,6-dichloroanilino)-2-oxoethyl]amino]acetic acid (PubChem CID 63646991) has the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(2,6-dichloroanilino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(2,6-dichloroanilino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 63646991 |
| Molecular Formula | C12H12Cl2N2O5 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[carboxymethyl-[2-(2,6-dichloroanilino)-2-oxoethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O5/c13-7-2-1-3-8(14)12(7)15-9(17)4-16(5-10(18)19)6-11(20)21/h1-3H,4-6H2,(H,15,17)(H,18,19)(H,20,21) |
| InChIKey | IYKDTHRIJPDRQA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |