C13H17Cl3N2O2 — CID 770145
2-methyl-N-[(1R)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]propanamide (PubChem CID 770145) has the molecular formula C13H17Cl3N2O2 and a molecular weight of 339.65 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 770145 |
| Molecular Formula | C13H17Cl3N2O2 |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-methyl-N-[(1R)-2,2,2-trichloro-1-(2-methoxyanilino)ethyl]propanamide |
| SMILES | COc1ccccc1N[C@H](NC(=O)C(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H17Cl3N2O2/c1-8(2)11(19)18-12(13(14,15)16)17-9-6-4-5-7-10(9)20-3/h4-8,12,17H,1-3H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | QOFPVZUAUKRVMX-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|