C15H16Cl2N2O5S — CID 43020961
2-chloroprop-2-enyl 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 43020961) has the molecular formula C15H16Cl2N2O5S and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | 2-chloroprop-2-enyl 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 43020961 |
| Molecular Formula | C15H16Cl2N2O5S |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[(2-chloro-4-nitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | C=C(Cl)COC(=O)C(CCSC)NC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O5S/c1-9(16)8-24-15(21)13(5-6-25-2)18-14(20)11-4-3-10(19(22)23)7-12(11)17/h3-4,7,13H,1,5-6,8H2,2H3,(H,18,20) |
| InChIKey | DQYRCXFLKINUJF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|