C21H18Cl2N4O6S — CID 98384594
[2-(2-cyano-4-nitroanilino)-2-oxoethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 98384594) has the molecular formula C21H18Cl2N4O6S and a molecular weight of 525.37 g/mol. Its IUPAC name is [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 98384594 |
| Molecular Formula | C21H18Cl2N4O6S |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | [2-(2-cyano-4-nitroanilino)-2-oxoethyl] (2S)-2-[(2,4-dichlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(Cl)cc1Cl)C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C#N |
| InChI | InChI=1S/C21H18Cl2N4O6S/c1-34-7-6-18(26-20(29)15-4-2-13(22)9-16(15)23)21(30)33-11-19(28)25-17-5-3-14(27(31)32)8-12(17)10-24/h2-5,8-9,18H,6-7,11H2,1H3,(H,25,28)(H,26,29)/t18-/m0/s1 |
| InChIKey | XXJAWURHMFMIHM-SFHVURJKSA-N |
| XLogP | 3.81 |
| TPSA | 151.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|