C20H19N5O6S — CID 55494271
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55494271) has the molecular formula C20H19N5O6S and a molecular weight of 457.47 g/mol. Its IUPAC name is (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55494271 |
| Molecular Formula | C20H19N5O6S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCc1nc(-c2cccnc2)no1 |
| InChI | InChI=1S/C20H19N5O6S/c1-32-9-7-16(22-19(26)13-4-2-6-15(10-13)25(28)29)20(27)30-12-17-23-18(24-31-17)14-5-3-8-21-11-14/h2-6,8,10-11,16H,7,9,12H2,1H3,(H,22,26) |
| InChIKey | GAGNZOFNKCKMJC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|