C16H21BrN2O4S — CID 51065009
methyl 2-[3-[(2-bromobenzoyl)amino]propanoylamino]-4-methylsulfanylbutanoate (PubChem CID 51065009) has the molecular formula C16H21BrN2O4S and a molecular weight of 417.33 g/mol. Its IUPAC name is methyl 2-[3-[(2-bromobenzoyl)amino]propanoylamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[3-[(2-bromobenzoyl)amino]propanoylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 51065009 |
| Molecular Formula | C16H21BrN2O4S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | methyl 2-[3-[(2-bromobenzoyl)amino]propanoylamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)CCNC(=O)c1ccccc1Br |
| InChI | InChI=1S/C16H21BrN2O4S/c1-23-16(22)13(8-10-24-2)19-14(20)7-9-18-15(21)11-5-3-4-6-12(11)17/h3-6,13H,7-10H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | PDJRAJZMJVSUQU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |