C13H13Cl3N2O4 — CID 71960362
N-methyl-N-[1,1,1-trichloro-4-(4-nitrophenyl)-4-oxobutan-2-yl]acetamide (PubChem CID 71960362) has the molecular formula C13H13Cl3N2O4 and a molecular weight of 367.62 g/mol. Its IUPAC name is N-methyl-N-[1,1,1-trichloro-4-(4-nitrophenyl)-4-oxobutan-2-yl]acetamide.
| Compound Name | N-methyl-N-[1,1,1-trichloro-4-(4-nitrophenyl)-4-oxobutan-2-yl]acetamide |
|---|---|
| PubChem CID | 71960362 |
| Molecular Formula | C13H13Cl3N2O4 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | N-methyl-N-[1,1,1-trichloro-4-(4-nitrophenyl)-4-oxobutan-2-yl]acetamide |
| SMILES | CC(=O)N(C)C(CC(=O)c1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H13Cl3N2O4/c1-8(19)17(2)12(13(14,15)16)7-11(20)9-3-5-10(6-4-9)18(21)22/h3-6,12H,7H2,1-2H3 |
| InChIKey | AQVQLFUVONSWED-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|