C17H16O3 — CID 14316875
2-hydroxy-1,5-diphenylpentane-1,5-dione (PubChem CID 14316875) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-hydroxy-1,5-diphenylpentane-1,5-dione.
| Compound Name | 2-hydroxy-1,5-diphenylpentane-1,5-dione |
|---|---|
| PubChem CID | 14316875 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-hydroxy-1,5-diphenylpentane-1,5-dione |
| SMILES | O=C(CCC(O)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c18-15(13-7-3-1-4-8-13)11-12-16(19)17(20)14-9-5-2-6-10-14/h1-10,16,19H,11-12H2 |
| InChIKey | CEKHFDSQJYQGRL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |