C15H23N — CID 102122071
(2S)-N,2-dimethyl-N-[(1S)-1-phenylethyl]pent-4-en-1-amine (PubChem CID 102122071) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2S)-N,2-dimethyl-N-[(1S)-1-phenylethyl]pent-4-en-1-amine.
| Compound Name | (2S)-N,2-dimethyl-N-[(1S)-1-phenylethyl]pent-4-en-1-amine |
|---|---|
| PubChem CID | 102122071 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2S)-N,2-dimethyl-N-[(1S)-1-phenylethyl]pent-4-en-1-amine |
| SMILES | C=CC[C@H](C)CN(C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H23N/c1-5-9-13(2)12-16(4)14(3)15-10-7-6-8-11-15/h5-8,10-11,13-14H,1,9,12H2,2-4H3/t13-,14-/m0/s1 |
| InChIKey | GJWNFMTUHOGPTG-KBPBESRZSA-N |
| XLogP | 3.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|