C19H25NO2 — CID 88936729
(Z,7Z)-7-ethylidene-N-hydroxy-4-methylidene-10-phenyldec-5-enamide (PubChem CID 88936729) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (Z,7Z)-7-ethylidene-N-hydroxy-4-methylidene-10-phenyldec-5-enamide.
| Compound Name | (Z,7Z)-7-ethylidene-N-hydroxy-4-methylidene-10-phenyldec-5-enamide |
|---|---|
| PubChem CID | 88936729 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (Z,7Z)-7-ethylidene-N-hydroxy-4-methylidene-10-phenyldec-5-enamide |
| SMILES | C=C(/C=C\C(=C/C)CCCc1ccccc1)CCC(=O)NO |
| InChI | InChI=1S/C19H25NO2/c1-3-17(10-7-11-18-8-5-4-6-9-18)14-12-16(2)13-15-19(21)20-22/h3-6,8-9,12,14,22H,2,7,10-11,13,15H2,1H3,(H,20,21)/b14-12-,17-3- |
| InChIKey | JVPOPDSCZDZPQI-UFUZHUQUSA-N |
| XLogP | 4.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|