About butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene
butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene (PubChem CID 142361555) has the molecular formula C20H34O
and a molecular weight of 290.49 g/mol. Its IUPAC name is butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene |
| PubChem CID | 142361555 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene |
| SMILES | C=C(C)C.CCC(C)=O.CCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H18.C4H8O.C4H8/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-3-4(2)5;1-4(2)3/h6-9H,5H2,1-4H3;3H2,1-2H3;1H2,2-3H3 |
| InChIKey | UCPDDLKDYBZUPO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene?
The IUPAC name of butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene (CID 142361555) is butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene.
What is the SMILES notation for butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene?
The canonical SMILES for butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene is C=C(C)C.CCC(C)=O.CCc1ccc(C(C)(C)C)cc1.
What is the InChIKey of butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene?
The InChIKey is UCPDDLKDYBZUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C4H8O.C4H8/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-3-4(2)5;1-4(2)3/h6-9H,5H2,1-4H3;3H2,1-2H3;1H2,2-3H3.
What are the key properties of butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene?
butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene has a molecular weight of 290.49 g/mol, XLogP of 6.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1-tert-butyl-4-ethylbenzene;2-methylprop-1-ene is sourced from PubChem (CID 142361555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).